About 3-ethyl-5,8-dimethyltricyclo[5.2.1.02,6]decane
3-ethyl-5,8-dimethyltricyclo[5.2.1.02,6]decane (PubChem CID 59392103) has the molecular formula C14H24
and a molecular weight of 192.35 g/mol. Its IUPAC name is 3-ethyl-5,8-dimethyltricyclo[5.2.1.02,6]decane.
Molecular Properties
| Compound Name | 3-ethyl-5,8-dimethyltricyclo[5.2.1.02,6]decane |
| PubChem CID | 59392103 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | 3-ethyl-5,8-dimethyltricyclo[5.2.1.02,6]decane |
| SMILES | CCC1CC(C)C2C3CC(CC3C)C12 |
| InChI | InChI=1S/C14H24/c1-4-10-6-9(3)13-12-7-11(14(10)13)5-8(12)2/h8-14H,4-7H2,1-3H3 |
| InChIKey | TYFZECFEEVDYBN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-ethyl-5,8-dimethyltricyclo[5.2.1.02,6]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-5,8-dimethyltricyclo[5.2.1.02,6]decane?
The IUPAC name of 3-ethyl-5,8-dimethyltricyclo[5.2.1.02,6]decane (CID 59392103) is 3-ethyl-5,8-dimethyltricyclo[5.2.1.02,6]decane.
What is the SMILES notation for 3-ethyl-5,8-dimethyltricyclo[5.2.1.02,6]decane?
The canonical SMILES for 3-ethyl-5,8-dimethyltricyclo[5.2.1.02,6]decane is CCC1CC(C)C2C3CC(CC3C)C12.
What is the InChIKey of 3-ethyl-5,8-dimethyltricyclo[5.2.1.02,6]decane?
The InChIKey is TYFZECFEEVDYBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24/c1-4-10-6-9(3)13-12-7-11(14(10)13)5-8(12)2/h8-14H,4-7H2,1-3H3.
What are the key properties of 3-ethyl-5,8-dimethyltricyclo[5.2.1.02,6]decane?
3-ethyl-5,8-dimethyltricyclo[5.2.1.02,6]decane has a molecular weight of 192.35 g/mol, XLogP of 3.96, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-5,8-dimethyltricyclo[5.2.1.02,6]decane is sourced from PubChem (CID 59392103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).