C11H20O2 — CID 170528487
(2S,5S)-2-ethyl-5-methyl-1,2,3,3a,4,5,6,6a-octahydropentalene-1,6-diol (PubChem CID 170528487) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is (2S,5S)-2-ethyl-5-methyl-1,2,3,3a,4,5,6,6a-octahydropentalene-1,6-diol.
| Compound Name | (2S,5S)-2-ethyl-5-methyl-1,2,3,3a,4,5,6,6a-octahydropentalene-1,6-diol |
|---|---|
| PubChem CID | 170528487 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | (2S,5S)-2-ethyl-5-methyl-1,2,3,3a,4,5,6,6a-octahydropentalene-1,6-diol |
| SMILES | CC[C@H]1CC2C[C@H](C)C(O)C2C1O |
| InChI | InChI=1S/C11H20O2/c1-3-7-5-8-4-6(2)10(12)9(8)11(7)13/h6-13H,3-5H2,1-2H3/t6-,7-,8?,9?,10?,11?/m0/s1 |
| InChIKey | HMOPPGZQZSVJRW-YLLVLXDNSA-N |
| XLogP | 1.41 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |