About 10-ethyl-6-methyltetracyclo[5.4.0.02,5.08,11]undecane
10-ethyl-6-methyltetracyclo[5.4.0.02,5.08,11]undecane (PubChem CID 143368983) has the molecular formula C14H22
and a molecular weight of 190.33 g/mol. Its IUPAC name is 10-ethyl-6-methyltetracyclo[5.4.0.02,5.08,11]undecane.
Analyze 10-ethyl-6-methyltetracyclo[5.4.0.02,5.08,11]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-ethyl-6-methyltetracyclo[5.4.0.02,5.08,11]undecane?
The IUPAC name of 10-ethyl-6-methyltetracyclo[5.4.0.02,5.08,11]undecane (CID 143368983) is 10-ethyl-6-methyltetracyclo[5.4.0.02,5.08,11]undecane.
What is the SMILES notation for 10-ethyl-6-methyltetracyclo[5.4.0.02,5.08,11]undecane?
The canonical SMILES for 10-ethyl-6-methyltetracyclo[5.4.0.02,5.08,11]undecane is CCC1CC2C1C1C3CCC3C(C)C21.
What is the InChIKey of 10-ethyl-6-methyltetracyclo[5.4.0.02,5.08,11]undecane?
The InChIKey is ILZCQEXMADXDHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22/c1-3-8-6-11-12-7(2)9-4-5-10(9)14(12)13(8)11/h7-14H,3-6H2,1-2H3.
What are the key properties of 10-ethyl-6-methyltetracyclo[5.4.0.02,5.08,11]undecane?
10-ethyl-6-methyltetracyclo[5.4.0.02,5.08,11]undecane has a molecular weight of 190.33 g/mol, XLogP of 3.57, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 10-ethyl-6-methyltetracyclo[5.4.0.02,5.08,11]undecane is sourced from PubChem (CID 143368983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).