C10H20O — CID 123552020
1-ethyl-3-methoxy-2,4-dimethylcyclopentane (PubChem CID 123552020) has the molecular formula C10H20O and a molecular weight of 156.27 g/mol. Its IUPAC name is 1-ethyl-3-methoxy-2,4-dimethylcyclopentane.
| Compound Name | 1-ethyl-3-methoxy-2,4-dimethylcyclopentane |
|---|---|
| PubChem CID | 123552020 |
| Molecular Formula | C10H20O |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.15 |
| IUPAC Name | 1-ethyl-3-methoxy-2,4-dimethylcyclopentane |
| SMILES | CCC1CC(C)C(OC)C1C |
| InChI | InChI=1S/C10H20O/c1-5-9-6-7(2)10(11-4)8(9)3/h7-10H,5-6H2,1-4H3 |
| InChIKey | YJXJYOSGHOTJAG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |