C14H26 — CID 162292687
1,5-diethyl-2,4-dimethyl-1,2,3,3a,4,5,6,6a-octahydropentalene (PubChem CID 162292687) has the molecular formula C14H26 and a molecular weight of 194.36 g/mol. Its IUPAC name is 1,5-diethyl-2,4-dimethyl-1,2,3,3a,4,5,6,6a-octahydropentalene.
| Compound Name | 1,5-diethyl-2,4-dimethyl-1,2,3,3a,4,5,6,6a-octahydropentalene |
|---|---|
| PubChem CID | 162292687 |
| Molecular Formula | C14H26 |
| Molecular Weight | 194.36 g/mol |
| Exact Mass | 194.20 |
| IUPAC Name | 1,5-diethyl-2,4-dimethyl-1,2,3,3a,4,5,6,6a-octahydropentalene |
| SMILES | CCC1CC2C(CC)C(C)CC2C1C |
| InChI | InChI=1S/C14H26/c1-5-11-8-14-12(6-2)9(3)7-13(14)10(11)4/h9-14H,5-8H2,1-4H3 |
| InChIKey | TVJRVWUWENOTAO-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.36 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |