C14H33NO3 — CID 167697427
ethane;(1S,2R,3R,5R)-2,3,4-trimethoxy-5-methylcyclohexan-1-amine (PubChem CID 167697427) has the molecular formula C14H33NO3 and a molecular weight of 263.42 g/mol. Its IUPAC name is ethane;(1S,2R,3R,5R)-2,3,4-trimethoxy-5-methylcyclohexan-1-amine.
| Compound Name | ethane;(1S,2R,3R,5R)-2,3,4-trimethoxy-5-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 167697427 |
| Molecular Formula | C14H33NO3 |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.25 |
| IUPAC Name | ethane;(1S,2R,3R,5R)-2,3,4-trimethoxy-5-methylcyclohexan-1-amine |
| SMILES | CC.CC.COC1[C@H](C)C[C@H](N)[C@@H](OC)[C@@H]1OC |
| InChI | InChI=1S/C10H21NO3.2C2H6/c1-6-5-7(11)9(13-3)10(14-4)8(6)12-2;2*1-2/h6-10H,5,11H2,1-4H3;2*1-2H3/t6-,7+,8?,9-,10-;;/m1../s1 |
| InChIKey | XWGJTMDXVMXLHG-HNLJTAOBSA-N |
| XLogP | 2.45 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |