C18H42CuN6O6+2 — CID 6397776
copper bis(2,4,6-trimethoxycyclohexane-1,3,5-triamine) (PubChem CID 6397776) has the molecular formula C18H42CuN6O6+2 and a molecular weight of 502.12 g/mol. Its IUPAC name is copper bis(2,4,6-trimethoxycyclohexane-1,3,5-triamine).
| Compound Name | copper bis(2,4,6-trimethoxycyclohexane-1,3,5-triamine) |
|---|---|
| PubChem CID | 6397776 |
| Molecular Formula | C18H42CuN6O6+2 |
| Molecular Weight | 502.12 g/mol |
| Exact Mass | 501.25 |
| IUPAC Name | copper bis(2,4,6-trimethoxycyclohexane-1,3,5-triamine) |
| SMILES | COC1C(N)C(OC)C(N)C(OC)C1N.COC1C(N)C(OC)C(N)C(OC)C1N.[Cu+2] |
| InChI | InChI=1S/2C9H21N3O3.Cu/c2*1-13-7-4(10)8(14-2)6(12)9(15-3)5(7)11;/h2*4-9H,10-12H2,1-3H3;/q;;+2 |
| InChIKey | NIKWTOHLCMPAKB-UHFFFAOYSA-N |
| XLogP | -3.95 |
| TPSA | 211.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.12 |
| LogP ≤ 5 | -3.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |