C8H12Cl4O2 — CID 23273972
1,2,3,4-tetrachloro-5,6-dimethoxycyclohexane (PubChem CID 23273972) has the molecular formula C8H12Cl4O2 and a molecular weight of 281.99 g/mol. Its IUPAC name is 1,2,3,4-tetrachloro-5,6-dimethoxycyclohexane.
| Compound Name | 1,2,3,4-tetrachloro-5,6-dimethoxycyclohexane |
|---|---|
| PubChem CID | 23273972 |
| Molecular Formula | C8H12Cl4O2 |
| Molecular Weight | 281.99 g/mol |
| Exact Mass | 279.96 |
| IUPAC Name | 1,2,3,4-tetrachloro-5,6-dimethoxycyclohexane |
| SMILES | COC1C(Cl)C(Cl)C(Cl)C(Cl)C1OC |
| InChI | InChI=1S/C8H12Cl4O2/c1-13-7-5(11)3(9)4(10)6(12)8(7)14-2/h3-8H,1-2H3 |
| InChIKey | HVDOBUIEECQYKE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.99 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|