C9H11Cl7 — CID 88651642
chlorocyclopropane;1,2,3,4,5,6-hexachlorocyclohexane (PubChem CID 88651642) has the molecular formula C9H11Cl7 and a molecular weight of 367.36 g/mol. Its IUPAC name is chlorocyclopropane;1,2,3,4,5,6-hexachlorocyclohexane.
| Compound Name | chlorocyclopropane;1,2,3,4,5,6-hexachlorocyclohexane |
|---|---|
| PubChem CID | 88651642 |
| Molecular Formula | C9H11Cl7 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 363.87 |
| IUPAC Name | chlorocyclopropane;1,2,3,4,5,6-hexachlorocyclohexane |
| SMILES | ClC1C(Cl)C(Cl)C(Cl)C(Cl)C1Cl.ClC1CC1 |
| InChI | InChI=1S/C6H6Cl6.C3H5Cl/c7-1-2(8)4(10)6(12)5(11)3(1)9;4-3-1-2-3/h1-6H;3H,1-2H2 |
| InChIKey | YZWHGGLGPXJQLS-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|