C6H10Cl2 — CID 22214628
trans-(1S,3S)-1,3-dichlorocyclohexane (PubChem CID 22214628) has the molecular formula C6H10Cl2 and a molecular weight of 153.05 g/mol. Its IUPAC name is trans-(1S,3S)-1,3-dichlorocyclohexane.
| Compound Name | trans-(1S,3S)-1,3-dichlorocyclohexane |
|---|---|
| PubChem CID | 22214628 |
| Molecular Formula | C6H10Cl2 |
| Molecular Weight | 153.05 g/mol |
| Exact Mass | 152.02 |
| IUPAC Name | trans-(1S,3S)-1,3-dichlorocyclohexane |
| SMILES | Cl[C@H]1CCC[C@H](Cl)C1 |
| InChI | InChI=1S/C6H10Cl2/c7-5-2-1-3-6(8)4-5/h5-6H,1-4H2/t5-,6-/m0/s1 |
| InChIKey | HXWLCXAXTOJPJL-WDSKDSINSA-N |
| XLogP | 2.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.05 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|