C18H39FN2O5 — CID 167622244
N-[(1R,3S,4R,5S)-5-amino-2,3,4-trimethoxycyclohexyl]-3-fluoro-2-hydroxypentanamide;ethane (PubChem CID 167622244) has the molecular formula C18H39FN2O5 and a molecular weight of 382.52 g/mol. Its IUPAC name is N-[(1R,3S,4R,5S)-5-amino-2,3,4-trimethoxycyclohexyl]-3-fluoro-2-hydroxypentanamide;ethane.
| Compound Name | N-[(1R,3S,4R,5S)-5-amino-2,3,4-trimethoxycyclohexyl]-3-fluoro-2-hydroxypentanamide;ethane |
|---|---|
| PubChem CID | 167622244 |
| Molecular Formula | C18H39FN2O5 |
| Molecular Weight | 382.52 g/mol |
| Exact Mass | 382.28 |
| IUPAC Name | N-[(1R,3S,4R,5S)-5-amino-2,3,4-trimethoxycyclohexyl]-3-fluoro-2-hydroxypentanamide;ethane |
| SMILES | CC.CC.CCC(F)C(O)C(=O)N[C@@H]1C[C@H](N)[C@@H](OC)[C@H](OC)C1OC |
| InChI | InChI=1S/C14H27FN2O5.2C2H6/c1-5-7(15)10(18)14(19)17-9-6-8(16)11(20-2)13(22-4)12(9)21-3;2*1-2/h7-13,18H,5-6,16H2,1-4H3,(H,17,19);2*1-2H3/t7?,8-,9+,10?,11+,12?,13-;;/m0../s1 |
| InChIKey | MPKWKWGCIYYXDK-PNIMASRCSA-N |
| XLogP | 1.41 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.52 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |