C11H22O3 — CID 163476629
(2R)-3-ethyl-2-methoxy-6-(methoxymethyl)-5-methyloxane (PubChem CID 163476629) has the molecular formula C11H22O3 and a molecular weight of 202.29 g/mol. Its IUPAC name is (2R)-3-ethyl-2-methoxy-6-(methoxymethyl)-5-methyloxane.
| Compound Name | (2R)-3-ethyl-2-methoxy-6-(methoxymethyl)-5-methyloxane |
|---|---|
| PubChem CID | 163476629 |
| Molecular Formula | C11H22O3 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.16 |
| IUPAC Name | (2R)-3-ethyl-2-methoxy-6-(methoxymethyl)-5-methyloxane |
| SMILES | CCC1CC(C)C(COC)O[C@H]1OC |
| InChI | InChI=1S/C11H22O3/c1-5-9-6-8(2)10(7-12-3)14-11(9)13-4/h8-11H,5-7H2,1-4H3/t8?,9?,10?,11-/m1/s1 |
| InChIKey | CAZDYYAAKXUZAT-AHELAYONSA-N |
| XLogP | 2.06 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |