About 3-(2-methoxy-2-methylpropyl)-3,5-dimethyloxolan-2-one
3-(2-methoxy-2-methylpropyl)-3,5-dimethyloxolan-2-one (PubChem CID 164773995) has the molecular formula C11H20O3
and a molecular weight of 200.28 g/mol. Its IUPAC name is 3-(2-methoxy-2-methylpropyl)-3,5-dimethyloxolan-2-one.
Analyze 3-(2-methoxy-2-methylpropyl)-3,5-dimethyloxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methoxy-2-methylpropyl)-3,5-dimethyloxolan-2-one?
The IUPAC name of 3-(2-methoxy-2-methylpropyl)-3,5-dimethyloxolan-2-one (CID 164773995) is 3-(2-methoxy-2-methylpropyl)-3,5-dimethyloxolan-2-one.
What is the SMILES notation for 3-(2-methoxy-2-methylpropyl)-3,5-dimethyloxolan-2-one?
The canonical SMILES for 3-(2-methoxy-2-methylpropyl)-3,5-dimethyloxolan-2-one is COC(C)(C)CC1(C)CC(C)OC1=O.
What is the InChIKey of 3-(2-methoxy-2-methylpropyl)-3,5-dimethyloxolan-2-one?
The InChIKey is TYBDMMBYDFIPAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O3/c1-8-6-11(4,9(12)14-8)7-10(2,3)13-5/h8H,6-7H2,1-5H3.
What are the key properties of 3-(2-methoxy-2-methylpropyl)-3,5-dimethyloxolan-2-one?
3-(2-methoxy-2-methylpropyl)-3,5-dimethyloxolan-2-one has a molecular weight of 200.28 g/mol, XLogP of 2.14, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methoxy-2-methylpropyl)-3,5-dimethyloxolan-2-one is sourced from PubChem (CID 164773995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).