C13H18 — CID 147978015
2-methylpentacyclo[6.4.0.02,10.03,7.04,9]dodecane (PubChem CID 147978015) has the molecular formula C13H18 and a molecular weight of 174.29 g/mol. Its IUPAC name is 2-methylpentacyclo[6.4.0.02,10.03,7.04,9]dodecane.
| Compound Name | 2-methylpentacyclo[6.4.0.02,10.03,7.04,9]dodecane |
|---|---|
| PubChem CID | 147978015 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | 2-methylpentacyclo[6.4.0.02,10.03,7.04,9]dodecane |
| SMILES | CC12C3CCC1C1C4CCC(C13)C42 |
| InChI | InChI=1S/C13H18/c1-13-8-4-5-9(13)11-7-3-2-6(10(8)11)12(7)13/h6-12H,2-5H2,1H3 |
| InChIKey | ISRBLGVTTNTURH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |