C14H18O2 — CID 139054009
(1S,2R,3R,4R,5S,7R,8R,9S,10R)-4-methoxy-2-methylpentacyclo[6.4.0.02,10.03,7.05,9]dodecan-6-one (PubChem CID 139054009) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is (1S,2R,3R,4R,5S,7R,8R,9S,10R)-4-methoxy-2-methylpentacyclo[6.4.0.02,10.03,7.05,9]dodecan-6-one.
| Compound Name | (1S,2R,3R,4R,5S,7R,8R,9S,10R)-4-methoxy-2-methylpentacyclo[6.4.0.02,10.03,7.05,9]dodecan-6-one |
|---|---|
| PubChem CID | 139054009 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | (1S,2R,3R,4R,5S,7R,8R,9S,10R)-4-methoxy-2-methylpentacyclo[6.4.0.02,10.03,7.05,9]dodecan-6-one |
| SMILES | CO[C@H]1[C@H]2C(=O)[C@@H]3[C@@H]4[C@H]2[C@H]2CC[C@@H]4[C@@]2(C)[C@H]13 |
| InChI | InChI=1S/C14H18O2/c1-14-5-3-4-6(14)8-7(5)9-11(14)13(16-2)10(8)12(9)15/h5-11,13H,3-4H2,1-2H3/t5-,6+,7-,8+,9+,10+,11-,13-,14+/m0/s1 |
| InChIKey | MKRDQPIKHIANQG-QARJHKPMSA-N |
| XLogP | 1.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |