C20H30O3 — CID 100932552
[(3aS,5aS,5bR,6R,9aS,10aS,10bS)-3a,5b-dimethyl-10-oxo-2,3,4,5,5a,6,7,8,9,9a,10a,10b-dodecahydro-1H-cyclopenta[a]fluoren-6-yl] acetate (PubChem CID 100932552) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is [(3aS,5aS,5bR,6R,9aS,10aS,10bS)-3a,5b-dimethyl-10-oxo-2,3,4,5,5a,6,7,8,9,9a,10a,10b-dodecahydro-1H-cyclopenta[a]fluoren-6-yl] acetate.
| Compound Name | [(3aS,5aS,5bR,6R,9aS,10aS,10bS)-3a,5b-dimethyl-10-oxo-2,3,4,5,5a,6,7,8,9,9a,10a,10b-dodecahydro-1H-cyclopenta[a]fluoren-6-yl] acetate |
|---|---|
| PubChem CID | 100932552 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | [(3aS,5aS,5bR,6R,9aS,10aS,10bS)-3a,5b-dimethyl-10-oxo-2,3,4,5,5a,6,7,8,9,9a,10a,10b-dodecahydro-1H-cyclopenta[a]fluoren-6-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CCC[C@@H]2C(=O)[C@H]3[C@@H]4CCC[C@@]4(C)CC[C@@H]3[C@]21C |
| InChI | InChI=1S/C20H30O3/c1-12(21)23-16-8-4-6-15-18(22)17-13-7-5-10-19(13,2)11-9-14(17)20(15,16)3/h13-17H,4-11H2,1-3H3/t13-,14-,15+,16+,17-,19-,20+/m0/s1 |
| InChIKey | YWVSGHMRTIQZSF-PYVIVZLWSA-N |
| XLogP | 4.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |