C26H38ClNO5 — CID 86630523
[(1R,3R,8S,9S,10R,13S,14S)-1-acetyloxy-7-(3-chloropropoxyimino)-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 86630523) has the molecular formula C26H38ClNO5 and a molecular weight of 480.05 g/mol. Its IUPAC name is [(1R,3R,8S,9S,10R,13S,14S)-1-acetyloxy-7-(3-chloropropoxyimino)-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(1R,3R,8S,9S,10R,13S,14S)-1-acetyloxy-7-(3-chloropropoxyimino)-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 86630523 |
| Molecular Formula | C26H38ClNO5 |
| Molecular Weight | 480.05 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | [(1R,3R,8S,9S,10R,13S,14S)-1-acetyloxy-7-(3-chloropropoxyimino)-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC2=CC(=NOCCCCl)[C@H]3[C@@H]4CCC[C@@]4(C)CC[C@@H]3[C@@]2(C)[C@H](OC(C)=O)C1 |
| InChI | InChI=1S/C26H38ClNO5/c1-16(29)32-19-13-18-14-22(28-31-12-6-11-27)24-20-7-5-9-25(20,3)10-8-21(24)26(18,4)23(15-19)33-17(2)30/h14,19-21,23-24H,5-13,15H2,1-4H3/t19-,20+,21+,23-,24+,25+,26+/m1/s1 |
| InChIKey | JYGUXRGGOPBMCS-GEBCKKKGSA-N |
| XLogP | 5.42 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.05 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|