C37H54O4Se — CID 88834569
[(1S,7R,10R,13R,17R)-1-acetyloxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-7-phenylselanyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 88834569) has the molecular formula C37H54O4Se and a molecular weight of 641.80 g/mol. Its IUPAC name is [(1S,7R,10R,13R,17R)-1-acetyloxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-7-phenylselanyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(1S,7R,10R,13R,17R)-1-acetyloxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-7-phenylselanyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 88834569 |
| Molecular Formula | C37H54O4Se |
| Molecular Weight | 641.80 g/mol |
| Exact Mass | 642.32 |
| IUPAC Name | [(1S,7R,10R,13R,17R)-1-acetyloxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-7-phenylselanyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)OC1CC2=CC([Se]c3ccccc3)C3C4CC[C@H]([C@H](C)CCCC(C)C)[C@@]4(C)CCC3[C@@]2(C)[C@@H](OC(C)=O)C1 |
| InChI | InChI=1S/C37H54O4Se/c1-23(2)12-11-13-24(3)30-16-17-31-35-32(18-19-36(30,31)6)37(7)27(21-33(35)42-29-14-9-8-10-15-29)20-28(40-25(4)38)22-34(37)41-26(5)39/h8-10,14-15,21,23-24,28,30-35H,11-13,16-20,22H2,1-7H3/t24-,28?,30-,31?,32?,33?,34+,35?,36-,37+/m1/s1 |
| InChIKey | NOBDLBCDOOXJQJ-KFWFAOKQSA-N |
| XLogP | 7.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.80 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|