C29H41N3O5 — CID 86761755
[(3S,8R,9S,10R,13S,14S,17S)-17-acetyloxy-7-(3-imidazol-1-ylpropoxyimino)-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate (PubChem CID 86761755) has the molecular formula C29H41N3O5 and a molecular weight of 511.66 g/mol. Its IUPAC name is [(3S,8R,9S,10R,13S,14S,17S)-17-acetyloxy-7-(3-imidazol-1-ylpropoxyimino)-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate.
| Compound Name | [(3S,8R,9S,10R,13S,14S,17S)-17-acetyloxy-7-(3-imidazol-1-ylpropoxyimino)-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|---|
| PubChem CID | 86761755 |
| Molecular Formula | C29H41N3O5 |
| Molecular Weight | 511.66 g/mol |
| Exact Mass | 511.30 |
| IUPAC Name | [(3S,8R,9S,10R,13S,14S,17S)-17-acetyloxy-7-(3-imidazol-1-ylpropoxyimino)-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(=CC(=NOCCCn3ccnc3)[C@H]3[C@@H]4CC[C@H](OC(C)=O)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C29H41N3O5/c1-19(33)36-22-8-10-28(3)21(16-22)17-25(31-35-15-5-13-32-14-12-30-18-32)27-23-6-7-26(37-20(2)34)29(23,4)11-9-24(27)28/h12,14,17-18,22-24,26-27H,5-11,13,15-16H2,1-4H3/t22-,23-,24-,26-,27-,28-,29-/m0/s1 |
| InChIKey | BTUGCJZVAUSMFD-ZQGXUALKSA-N |
| XLogP | 5.08 |
| TPSA | 92.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.66 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|