C25H37N3O3 — CID 46927976
(3S,7Z,10R,13S,17S)-7-(3-imidazol-1-ylpropoxyimino)-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 46927976) has the molecular formula C25H37N3O3 and a molecular weight of 427.59 g/mol. Its IUPAC name is (3S,7Z,10R,13S,17S)-7-(3-imidazol-1-ylpropoxyimino)-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (3S,7Z,10R,13S,17S)-7-(3-imidazol-1-ylpropoxyimino)-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 46927976 |
| Molecular Formula | C25H37N3O3 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.28 |
| IUPAC Name | (3S,7Z,10R,13S,17S)-7-(3-imidazol-1-ylpropoxyimino)-10,13-dimethyl-1,2,3,4,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C[C@]12CC[C@H](O)CC1=C/C(=N\OCCCn1ccnc1)C1C2CC[C@@]2(C)C1CC[C@@H]2O |
| InChI | InChI=1S/C25H37N3O3/c1-24-8-6-18(29)14-17(24)15-21(27-31-13-3-11-28-12-10-26-16-28)23-19-4-5-22(30)25(19,2)9-7-20(23)24/h10,12,15-16,18-20,22-23,29-30H,3-9,11,13-14H2,1-2H3/b27-21+/t18-,19?,20?,22-,23?,24-,25-/m0/s1 |
| InChIKey | MPSMCGHSNUQONK-IUVMQBFASA-N |
| XLogP | 3.94 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|