C20H24O6 — CID 10247945
(1R,4S,6R,9S,10S,12R,13S,15R)-5,5,16,16-tetramethoxyheptacyclo[7.6.1.02,8.03,7.04,13.06,12.010,15]hexadecane-11,14-dione (PubChem CID 10247945) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is (1R,4S,6R,9S,10S,12R,13S,15R)-5,5,16,16-tetramethoxyheptacyclo[7.6.1.02,8.03,7.04,13.06,12.010,15]hexadecane-11,14-dione.
| Compound Name | (1R,4S,6R,9S,10S,12R,13S,15R)-5,5,16,16-tetramethoxyheptacyclo[7.6.1.02,8.03,7.04,13.06,12.010,15]hexadecane-11,14-dione |
|---|---|
| PubChem CID | 10247945 |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (1R,4S,6R,9S,10S,12R,13S,15R)-5,5,16,16-tetramethoxyheptacyclo[7.6.1.02,8.03,7.04,13.06,12.010,15]hexadecane-11,14-dione |
| SMILES | COC1(OC)[C@@H]2C3C4C5C3[C@H]3[C@H]6C(=O)[C@@H]2[C@H](C(=O)[C@H]6[C@@H]5C3(OC)OC)[C@H]41 |
| InChI | InChI=1S/C20H24O6/c1-23-19(24-2)13-5-6-8-7(5)15-11-12(16(8)20(15,25-3)26-4)18(22)10(14(6)19)9(13)17(11)21/h5-16H,1-4H3/t5?,6?,7?,8?,9-,10+,11+,12-,13-,14+,15+,16- |
| InChIKey | XUZCFTNQCHKXPC-PMHQQILASA-N |
| XLogP | 0.59 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cycloheptane_1', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|