C16H18Br2O6 — CID 23231702
(1S,2S,3R,4R,5S,8R,9S,10S)-3,4-dibromo-7,7,12,12-tetramethoxypentacyclo[6.4.0.02,5.03,10.04,9]dodecane-6,11-dione (PubChem CID 23231702) has the molecular formula C16H18Br2O6 and a molecular weight of 466.12 g/mol. Its IUPAC name is (1S,2S,3R,4R,5S,8R,9S,10S)-3,4-dibromo-7,7,12,12-tetramethoxypentacyclo[6.4.0.02,5.03,10.04,9]dodecane-6,11-dione.
| Compound Name | (1S,2S,3R,4R,5S,8R,9S,10S)-3,4-dibromo-7,7,12,12-tetramethoxypentacyclo[6.4.0.02,5.03,10.04,9]dodecane-6,11-dione |
|---|---|
| PubChem CID | 23231702 |
| Molecular Formula | C16H18Br2O6 |
| Molecular Weight | 466.12 g/mol |
| Exact Mass | 463.95 |
| IUPAC Name | (1S,2S,3R,4R,5S,8R,9S,10S)-3,4-dibromo-7,7,12,12-tetramethoxypentacyclo[6.4.0.02,5.03,10.04,9]dodecane-6,11-dione |
| SMILES | COC1(OC)C(=O)[C@@H]2[C@@H]3[C@@H]4[C@@H]1[C@H]1[C@@H](C(=O)C4(OC)OC)[C@@]3(Br)[C@@]12Br |
| InChI | InChI=1S/C16H18Br2O6/c1-21-15(22-2)7-5-10-12(20)16(23-3,24-4)8(7)6-9(11(15)19)13(5,17)14(6,10)18/h5-10H,1-4H3/t5-,6-,7-,8+,9-,10-,13+,14+/m0/s1 |
| InChIKey | BTKRCAHGAPLIMK-NDEKGWEHSA-N |
| XLogP | 1.14 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.12 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|