C13H15BrO5 — CID 10925581
(1S,2S,6S,7S)-10-bromo-9,9-dimethoxy-11-methyl-3-oxatricyclo[5.2.2.02,6]undec-10-ene-4,8-dione (PubChem CID 10925581) has the molecular formula C13H15BrO5 and a molecular weight of 331.16 g/mol. Its IUPAC name is (1S,2S,6S,7S)-10-bromo-9,9-dimethoxy-11-methyl-3-oxatricyclo[5.2.2.02,6]undec-10-ene-4,8-dione.
| Compound Name | (1S,2S,6S,7S)-10-bromo-9,9-dimethoxy-11-methyl-3-oxatricyclo[5.2.2.02,6]undec-10-ene-4,8-dione |
|---|---|
| PubChem CID | 10925581 |
| Molecular Formula | C13H15BrO5 |
| Molecular Weight | 331.16 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | (1S,2S,6S,7S)-10-bromo-9,9-dimethoxy-11-methyl-3-oxatricyclo[5.2.2.02,6]undec-10-ene-4,8-dione |
| SMILES | COC1(OC)C(=O)[C@@H]2C(C)=C(Br)[C@H]1[C@H]1OC(=O)C[C@@H]21 |
| InChI | InChI=1S/C13H15BrO5/c1-5-8-6-4-7(15)19-11(6)9(10(5)14)13(17-2,18-3)12(8)16/h6,8-9,11H,4H2,1-3H3/t6-,8+,9-,11-/m0/s1 |
| InChIKey | JSQBJHHBKNRJCK-HLFIEIIFSA-N |
| XLogP | 1.40 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.16 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|