C13H14O6 — CID 101067757
methyl (1S,2S,6S,7S)-1,11-dimethyl-4,8-dioxo-3,9-dioxatricyclo[5.2.2.02,6]undec-10-ene-10-carboxylate (PubChem CID 101067757) has the molecular formula C13H14O6 and a molecular weight of 266.25 g/mol. Its IUPAC name is methyl (1S,2S,6S,7S)-1,11-dimethyl-4,8-dioxo-3,9-dioxatricyclo[5.2.2.02,6]undec-10-ene-10-carboxylate.
| Compound Name | methyl (1S,2S,6S,7S)-1,11-dimethyl-4,8-dioxo-3,9-dioxatricyclo[5.2.2.02,6]undec-10-ene-10-carboxylate |
|---|---|
| PubChem CID | 101067757 |
| Molecular Formula | C13H14O6 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.08 |
| IUPAC Name | methyl (1S,2S,6S,7S)-1,11-dimethyl-4,8-dioxo-3,9-dioxatricyclo[5.2.2.02,6]undec-10-ene-10-carboxylate |
| SMILES | COC(=O)C1=C(C)[C@H]2C(=O)O[C@]1(C)[C@H]1OC(=O)C[C@@H]21 |
| InChI | InChI=1S/C13H14O6/c1-5-8-6-4-7(14)18-10(6)13(2,19-11(8)15)9(5)12(16)17-3/h6,8,10H,4H2,1-3H3/t6-,8+,10-,13-/m0/s1 |
| InChIKey | MXRIQZXRIULQBT-QXUSJZOJSA-N |
| XLogP | 0.35 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|