C11H12O2 — CID 130993218
(1S,2S,3R,5S,7R,8R,9R)-4-methoxypentacyclo[5.3.0.02,5.03,9.04,8]decan-6-one (PubChem CID 130993218) has the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. Its IUPAC name is (1S,2S,3R,5S,7R,8R,9R)-4-methoxypentacyclo[5.3.0.02,5.03,9.04,8]decan-6-one.
| Compound Name | (1S,2S,3R,5S,7R,8R,9R)-4-methoxypentacyclo[5.3.0.02,5.03,9.04,8]decan-6-one |
|---|---|
| PubChem CID | 130993218 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | (1S,2S,3R,5S,7R,8R,9R)-4-methoxypentacyclo[5.3.0.02,5.03,9.04,8]decan-6-one |
| SMILES | COC12[C@@H]3[C@@H]4C[C@@H]5[C@H]3C(=O)[C@H]1[C@@H]5[C@@H]42 |
| InChI | InChI=1S/C11H12O2/c1-13-11-7-4-2-3-5(7)9(11)10(12)6(3)8(4)11/h3-9H,2H2,1H3/t3-,4+,5-,6+,7+,8+,9+,11?/m0/s1 |
| InChIKey | OASLWLFYQLRSIS-TYKOZWKYSA-N |
| XLogP | 0.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |