C15H16O3 — CID 10538254
[(1R,2R,3S,5R,6R,8R,9S,10R,11R,12R)-7-oxo-1-hexacyclo[6.5.0.02,6.03,11.05,10.09,12]tridecanyl] acetate (PubChem CID 10538254) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is [(1R,2R,3S,5R,6R,8R,9S,10R,11R,12R)-7-oxo-1-hexacyclo[6.5.0.02,6.03,11.05,10.09,12]tridecanyl] acetate.
| Compound Name | [(1R,2R,3S,5R,6R,8R,9S,10R,11R,12R)-7-oxo-1-hexacyclo[6.5.0.02,6.03,11.05,10.09,12]tridecanyl] acetate |
|---|---|
| PubChem CID | 10538254 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | [(1R,2R,3S,5R,6R,8R,9S,10R,11R,12R)-7-oxo-1-hexacyclo[6.5.0.02,6.03,11.05,10.09,12]tridecanyl] acetate |
| SMILES | CC(=O)O[C@@]12C[C@@H]3[C@@H]4[C@@H]5C[C@H]6[C@@H](C(=O)[C@@H]1[C@@H]3[C@H]64)[C@@H]52 |
| InChI | InChI=1S/C15H16O3/c1-4(16)18-15-3-7-8-6-2-5-9(8)10(7)13(15)14(17)11(5)12(6)15/h5-13H,2-3H2,1H3/t5-,6+,7-,8+,9-,10+,11-,12-,13+,15-/m1/s1 |
| InChIKey | KZCFKSQGJVBATG-XPJZUARMSA-N |
| XLogP | 1.26 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cycloheptane_1', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|