C12H13BrO — CID 99845168
(1R,2R,3R,5R,6S,7R,8R,9R,10S)-7-bromo-6-methylpentacyclo[6.3.0.02,6.03,10.05,9]undecan-4-one (PubChem CID 99845168) has the molecular formula C12H13BrO and a molecular weight of 253.14 g/mol. Its IUPAC name is (1R,2R,3R,5R,6S,7R,8R,9R,10S)-7-bromo-6-methylpentacyclo[6.3.0.02,6.03,10.05,9]undecan-4-one.
| Compound Name | (1R,2R,3R,5R,6S,7R,8R,9R,10S)-7-bromo-6-methylpentacyclo[6.3.0.02,6.03,10.05,9]undecan-4-one |
|---|---|
| PubChem CID | 99845168 |
| Molecular Formula | C12H13BrO |
| Molecular Weight | 253.14 g/mol |
| Exact Mass | 252.01 |
| IUPAC Name | (1R,2R,3R,5R,6S,7R,8R,9R,10S)-7-bromo-6-methylpentacyclo[6.3.0.02,6.03,10.05,9]undecan-4-one |
| SMILES | C[C@]12[C@@H]3[C@H]4C[C@@H]5[C@H]3C(=O)[C@@H]1[C@@H]5[C@@H]4[C@H]2Br |
| InChI | InChI=1S/C12H13BrO/c1-12-8-4-2-3-5(6(4)11(12)13)9(12)10(14)7(3)8/h3-9,11H,2H2,1H3/t3-,4-,5-,6+,7+,8+,9-,11+,12-/m0/s1 |
| InChIKey | DYJXAYHLFCEUAR-MCRQPCKVSA-N |
| XLogP | 2.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.14 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|