C23H28O — CID 10710859
(1R,2R,3S,4S,5R,8S,9R,10R,11S,12S,13R,14R,17S,18S)-3,10-dimethyloctacyclo[10.6.1.15,8.114,17.02,11.03,10.04,9.013,18]henicos-15-en-20-one (PubChem CID 10710859) has the molecular formula C23H28O and a molecular weight of 320.48 g/mol. Its IUPAC name is (1R,2R,3S,4S,5R,8S,9R,10R,11S,12S,13R,14R,17S,18S)-3,10-dimethyloctacyclo[10.6.1.15,8.114,17.02,11.03,10.04,9.013,18]henicos-15-en-20-one.
| Compound Name | (1R,2R,3S,4S,5R,8S,9R,10R,11S,12S,13R,14R,17S,18S)-3,10-dimethyloctacyclo[10.6.1.15,8.114,17.02,11.03,10.04,9.013,18]henicos-15-en-20-one |
|---|---|
| PubChem CID | 10710859 |
| Molecular Formula | C23H28O |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | (1R,2R,3S,4S,5R,8S,9R,10R,11S,12S,13R,14R,17S,18S)-3,10-dimethyloctacyclo[10.6.1.15,8.114,17.02,11.03,10.04,9.013,18]henicos-15-en-20-one |
| SMILES | C[C@]12[C@@H]3[C@@H]4C[C@@H]([C@@H]5[C@H]4[C@@H]4C=C[C@H]5C4=O)[C@@H]3[C@@]1(C)[C@@H]1[C@H]3CC[C@H](C3)[C@@H]12 |
| InChI | InChI=1S/C23H28O/c1-22-17-9-3-4-10(7-9)18(17)23(22,2)20-14-8-13(19(20)22)15-11-5-6-12(16(14)15)21(11)24/h5-6,9-20H,3-4,7-8H2,1-2H3/t9-,10+,11+,12-,13-,14+,15+,16-,17+,18-,19-,20+,22+,23- |
| InChIKey | GKFVXTKKKKIRLE-RQSJWNJOSA-N |
| XLogP | 4.19 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'cycloheptane_1', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|