C18H26O4 — CID 10709798
(1S,5R,6R,7S,8S,12R,13R,14S)-3,10-dimethylhexacyclo[10.2.1.15,8.02,11.03,10.04,9]hexadecane-6,7,13,14-tetrol (PubChem CID 10709798) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is (1S,5R,6R,7S,8S,12R,13R,14S)-3,10-dimethylhexacyclo[10.2.1.15,8.02,11.03,10.04,9]hexadecane-6,7,13,14-tetrol.
| Compound Name | (1S,5R,6R,7S,8S,12R,13R,14S)-3,10-dimethylhexacyclo[10.2.1.15,8.02,11.03,10.04,9]hexadecane-6,7,13,14-tetrol |
|---|---|
| PubChem CID | 10709798 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | (1S,5R,6R,7S,8S,12R,13R,14S)-3,10-dimethylhexacyclo[10.2.1.15,8.02,11.03,10.04,9]hexadecane-6,7,13,14-tetrol |
| SMILES | CC12C3C([C@@H]4C[C@H]3[C@@H](O)[C@H]4O)C1(C)C1C2[C@@H]2C[C@H]1[C@@H](O)[C@H]2O |
| InChI | InChI=1S/C18H26O4/c1-17-9-5-3-7(15(21)13(5)19)11(9)18(17,2)12-8-4-6(10(12)17)14(20)16(8)22/h5-16,19-22H,3-4H2,1-2H3/t5-,6+,7+,8-,9?,10?,11?,12?,13-,14+,15+,16-,17?,18? |
| InChIKey | SRLMAMNLPMZNDA-WQOLKYHTSA-N |
| XLogP | 0.23 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cycloheptane_1', 'substructure': 'N/A'} |
|---|