C9H14O2S — CID 130143517
4-thiatricyclo[5.2.1.02,6]decane-8,9-diol (PubChem CID 130143517) has the molecular formula C9H14O2S and a molecular weight of 186.28 g/mol. Its IUPAC name is 4-thiatricyclo[5.2.1.02,6]decane-8,9-diol.
| Compound Name | 4-thiatricyclo[5.2.1.02,6]decane-8,9-diol |
|---|---|
| PubChem CID | 130143517 |
| Molecular Formula | C9H14O2S |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | 4-thiatricyclo[5.2.1.02,6]decane-8,9-diol |
| SMILES | OC1C(O)C2CC1C1CSCC21 |
| InChI | InChI=1S/C9H14O2S/c10-8-4-1-5(9(8)11)7-3-12-2-6(4)7/h4-11H,1-3H2 |
| InChIKey | NLZUAGWPWDBSDC-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |