C18H26O2 — CID 169451108
(1R,5S,6S,7R,8R)-3,10-dimethylhexacyclo[10.2.1.15,8.02,11.03,10.04,9]hexadecane-6,7-diol (PubChem CID 169451108) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is (1R,5S,6S,7R,8R)-3,10-dimethylhexacyclo[10.2.1.15,8.02,11.03,10.04,9]hexadecane-6,7-diol.
| Compound Name | (1R,5S,6S,7R,8R)-3,10-dimethylhexacyclo[10.2.1.15,8.02,11.03,10.04,9]hexadecane-6,7-diol |
|---|---|
| PubChem CID | 169451108 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | (1R,5S,6S,7R,8R)-3,10-dimethylhexacyclo[10.2.1.15,8.02,11.03,10.04,9]hexadecane-6,7-diol |
| SMILES | CC12C3C4CC[C@H](C4)C3C1(C)C1C2[C@H]2C[C@@H]1[C@H](O)[C@@H]2O |
| InChI | InChI=1S/C18H26O2/c1-17-11-7-3-4-8(5-7)12(11)18(17,2)14-10-6-9(13(14)17)15(19)16(10)20/h7-16,19-20H,3-6H2,1-2H3/t7-,8?,9+,10-,11?,12?,13?,14?,15+,16-,17?,18?/m1/s1 |
| InChIKey | RVJNFTSZPVUMSC-FGJJKLLJSA-N |
| XLogP | 2.29 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cycloheptane_1', 'substructure': 'N/A'} |
|---|