C12H9Cl7O — CID 548783
1,5,8,9,10,11,11-heptachlorotetracyclo[6.2.1.13,6.02,7]dodec-9-en-4-ol (PubChem CID 548783) has the molecular formula C12H9Cl7O and a molecular weight of 417.37 g/mol. Its IUPAC name is 1,5,8,9,10,11,11-heptachlorotetracyclo[6.2.1.13,6.02,7]dodec-9-en-4-ol.
| Compound Name | 1,5,8,9,10,11,11-heptachlorotetracyclo[6.2.1.13,6.02,7]dodec-9-en-4-ol |
|---|---|
| PubChem CID | 548783 |
| Molecular Formula | C12H9Cl7O |
| Molecular Weight | 417.37 g/mol |
| Exact Mass | 413.85 |
| IUPAC Name | 1,5,8,9,10,11,11-heptachlorotetracyclo[6.2.1.13,6.02,7]dodec-9-en-4-ol |
| SMILES | OC1C(Cl)C2CC1C1C2C2(Cl)C(Cl)=C(Cl)C1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C12H9Cl7O/c13-6-2-1-3(7(6)20)5-4(2)10(16)8(14)9(15)11(5,17)12(10,18)19/h2-7,20H,1H2 |
| InChIKey | KAKBPXOZYDVIGI-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.37 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|