C11H10F2O — CID 146031272
(1R,5S,6S,7S,9R,10S)-11,11-difluoropentacyclo[5.4.0.02,6.03,10.05,9]undecan-8-one (PubChem CID 146031272) has the molecular formula C11H10F2O and a molecular weight of 196.20 g/mol. Its IUPAC name is (1R,5S,6S,7S,9R,10S)-11,11-difluoropentacyclo[5.4.0.02,6.03,10.05,9]undecan-8-one.
| Compound Name | (1R,5S,6S,7S,9R,10S)-11,11-difluoropentacyclo[5.4.0.02,6.03,10.05,9]undecan-8-one |
|---|---|
| PubChem CID | 146031272 |
| Molecular Formula | C11H10F2O |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | (1R,5S,6S,7S,9R,10S)-11,11-difluoropentacyclo[5.4.0.02,6.03,10.05,9]undecan-8-one |
| SMILES | O=C1[C@@H]2[C@H]3CC4C5[C@H]3[C@H]1[C@@H]5C(F)(F)[C@@H]42 |
| InChI | InChI=1S/C11H10F2O/c12-11(13)8-3-1-2-4-5(3)9(11)7(4)10(14)6(2)8/h2-9H,1H2/t2-,3?,4-,5?,6+,7-,8-,9+/m0/s1 |
| InChIKey | CYHPNDXJYYGKOV-DUEOJJKGSA-N |
| XLogP | 1.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |