C22H28O3 — CID 124911261
methyl (1S,2R,3S,4S,5S,6R,9R,10R,11R,12R,13S,14S,15S,19R)-12-hydroxy-13-methyloctacyclo[9.8.0.02,14.03,10.04,13.05,9.06,12.015,19]nonadecane-11-carboxylate (PubChem CID 124911261) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is methyl (1S,2R,3S,4S,5S,6R,9R,10R,11R,12R,13S,14S,15S,19R)-12-hydroxy-13-methyloctacyclo[9.8.0.02,14.03,10.04,13.05,9.06,12.015,19]nonadecane-11-carboxylate.
| Compound Name | methyl (1S,2R,3S,4S,5S,6R,9R,10R,11R,12R,13S,14S,15S,19R)-12-hydroxy-13-methyloctacyclo[9.8.0.02,14.03,10.04,13.05,9.06,12.015,19]nonadecane-11-carboxylate |
|---|---|
| PubChem CID | 124911261 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | methyl (1S,2R,3S,4S,5S,6R,9R,10R,11R,12R,13S,14S,15S,19R)-12-hydroxy-13-methyloctacyclo[9.8.0.02,14.03,10.04,13.05,9.06,12.015,19]nonadecane-11-carboxylate |
| SMILES | COC(=O)[C@@]12[C@@H]3[C@@H]4CC[C@@H]5[C@@H]4[C@@H]4[C@@H]3[C@@H]3[C@H]([C@H]6CCC[C@H]6[C@@H]31)[C@]4(C)[C@]52O |
| InChI | InChI=1S/C22H28O3/c1-20-15-8-4-3-5-9(8)16-13(15)14-17-10-6-7-11(12(10)18(14)20)22(20,24)21(16,17)19(23)25-2/h8-18,24H,3-7H2,1-2H3/t8-,9+,10+,11+,12+,13+,14+,15-,16-,17+,18+,20-,21-,22+/m0/s1 |
| InChIKey | LHSMBRLTQUGMJF-OAGBZVAXSA-N |
| XLogP | 2.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |