C23H30O3 — CID 98558216
methyl (1S,2R,3S,4R,7R,9R,10R,11S,15S,16S,17S,18S,19S)-9,17-dimethyl-8-oxoheptacyclo[8.8.1.02,9.03,7.04,18.011,15.016,19]nonadecane-17-carboxylate (PubChem CID 98558216) has the molecular formula C23H30O3 and a molecular weight of 354.49 g/mol. Its IUPAC name is methyl (1S,2R,3S,4R,7R,9R,10R,11S,15S,16S,17S,18S,19S)-9,17-dimethyl-8-oxoheptacyclo[8.8.1.02,9.03,7.04,18.011,15.016,19]nonadecane-17-carboxylate.
| Compound Name | methyl (1S,2R,3S,4R,7R,9R,10R,11S,15S,16S,17S,18S,19S)-9,17-dimethyl-8-oxoheptacyclo[8.8.1.02,9.03,7.04,18.011,15.016,19]nonadecane-17-carboxylate |
|---|---|
| PubChem CID | 98558216 |
| Molecular Formula | C23H30O3 |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | methyl (1S,2R,3S,4R,7R,9R,10R,11S,15S,16S,17S,18S,19S)-9,17-dimethyl-8-oxoheptacyclo[8.8.1.02,9.03,7.04,18.011,15.016,19]nonadecane-17-carboxylate |
| SMILES | COC(=O)[C@]1(C)[C@H]2[C@@H]3CC[C@H]4C(=O)[C@@]5(C)[C@H]([C@@H]2[C@H]2[C@H]5[C@H]5CCC[C@@H]5[C@@H]21)[C@H]34 |
| InChI | InChI=1S/C23H30O3/c1-22-16-9-5-4-6-10(9)17-14(16)15-18(23(17,2)21(25)26-3)11-7-8-12(20(22)24)13(11)19(15)22/h9-19H,4-8H2,1-3H3/t9-,10-,11+,12+,13+,14-,15+,16+,17-,18-,19-,22+,23-/m0/s1 |
| InChIKey | LNDZSDRDRJRABD-VWHVGJOQSA-N |
| XLogP | 3.57 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |