C24H30O3 — CID 98558210
methyl (1R,3R,4R,7S,8R,9S,10R,11S,12S,13R,14R,15S,16S,17R,20R)-4,10,15-trimethyl-2-oxanonacyclo[9.8.1.01,3.03,10.04,8.07,14.09,13.012,16.017,20]icosane-15-carboxylate (PubChem CID 98558210) has the molecular formula C24H30O3 and a molecular weight of 366.50 g/mol. Its IUPAC name is methyl (1R,3R,4R,7S,8R,9S,10R,11S,12S,13R,14R,15S,16S,17R,20R)-4,10,15-trimethyl-2-oxanonacyclo[9.8.1.01,3.03,10.04,8.07,14.09,13.012,16.017,20]icosane-15-carboxylate.
| Compound Name | methyl (1R,3R,4R,7S,8R,9S,10R,11S,12S,13R,14R,15S,16S,17R,20R)-4,10,15-trimethyl-2-oxanonacyclo[9.8.1.01,3.03,10.04,8.07,14.09,13.012,16.017,20]icosane-15-carboxylate |
|---|---|
| PubChem CID | 98558210 |
| Molecular Formula | C24H30O3 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | methyl (1R,3R,4R,7S,8R,9S,10R,11S,12S,13R,14R,15S,16S,17R,20R)-4,10,15-trimethyl-2-oxanonacyclo[9.8.1.01,3.03,10.04,8.07,14.09,13.012,16.017,20]icosane-15-carboxylate |
| SMILES | COC(=O)[C@@]1(C)[C@@H]2[C@H]3CC[C@]4(C)[C@H]3[C@@H]3[C@H]2[C@@H]2[C@@H]1[C@H]1CC[C@]56O[C@@]45[C@@]3(C)[C@@H]2[C@@H]16 |
| InChI | InChI=1S/C24H30O3/c1-20-7-5-9-13-11-12-14(21(13,2)19(25)26-4)10-6-8-23-16(10)18(12)22(3,17(11)15(9)20)24(20,23)27-23/h9-18H,5-8H2,1-4H3/t9-,10-,11+,12-,13-,14+,15-,16-,17+,18+,20-,21+,22-,23-,24-/m1/s1 |
| InChIKey | QOZOZVKTNHNZNM-WJBMCISZSA-N |
| XLogP | 3.52 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|