C12H17ClO3 — CID 165447665
methyl 2'-chloro-6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,3'-oxirane]-2'-carboxylate (PubChem CID 165447665) has the molecular formula C12H17ClO3 and a molecular weight of 244.72 g/mol. Its IUPAC name is methyl 2'-chloro-6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,3'-oxirane]-2'-carboxylate.
| Compound Name | methyl 2'-chloro-6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,3'-oxirane]-2'-carboxylate |
|---|---|
| PubChem CID | 165447665 |
| Molecular Formula | C12H17ClO3 |
| Molecular Weight | 244.72 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | methyl 2'-chloro-6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,3'-oxirane]-2'-carboxylate |
| SMILES | COC(=O)C1(Cl)OC12CCC1CC2C1(C)C |
| InChI | InChI=1S/C12H17ClO3/c1-10(2)7-4-5-11(8(10)6-7)12(13,16-11)9(14)15-3/h7-8H,4-6H2,1-3H3 |
| InChIKey | ITHHLKUMFLYJLL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.72 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|