C10H18O — CID 51004058
(1S,5S)-2,6,6-trimethylbicyclo[3.1.1]heptan-2-ol (PubChem CID 51004058) has the molecular formula C10H18O and a molecular weight of 154.25 g/mol. Its IUPAC name is (1S,5S)-2,6,6-trimethylbicyclo[3.1.1]heptan-2-ol.
| Compound Name | (1S,5S)-2,6,6-trimethylbicyclo[3.1.1]heptan-2-ol |
|---|---|
| PubChem CID | 51004058 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | (1S,5S)-2,6,6-trimethylbicyclo[3.1.1]heptan-2-ol |
| SMILES | CC1(O)CC[C@H]2C[C@H]1C2(C)C |
| InChI | InChI=1S/C10H18O/c1-9(2)7-4-5-10(3,11)8(9)6-7/h7-8,11H,4-6H2,1-3H3/t7-,8-,10?/m0/s1 |
| InChIKey | YYWZKGZIIKPPJZ-JIBHNJPVSA-N |
| XLogP | 2.19 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |