C11H16Br2 — CID 72961616
1',1'-dibromo-6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,2'-cyclopropane] (PubChem CID 72961616) has the molecular formula C11H16Br2 and a molecular weight of 308.06 g/mol. Its IUPAC name is 1',1'-dibromo-6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,2'-cyclopropane].
| Compound Name | 1',1'-dibromo-6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,2'-cyclopropane] |
|---|---|
| PubChem CID | 72961616 |
| Molecular Formula | C11H16Br2 |
| Molecular Weight | 308.06 g/mol |
| Exact Mass | 305.96 |
| IUPAC Name | 1',1'-dibromo-6,6-dimethylspiro[bicyclo[3.1.1]heptane-2,2'-cyclopropane] |
| SMILES | CC1(C)C2CCC3(CC3(Br)Br)C1C2 |
| InChI | InChI=1S/C11H16Br2/c1-9(2)7-3-4-10(8(9)5-7)6-11(10,12)13/h7-8H,3-6H2,1-2H3 |
| InChIKey | AOVPKLSTSVBBMC-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.06 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|