About methyl (1S,2S,6R,7S)-8-oxotricyclo[5.3.0.02,6]decane-1-carboxylate
methyl (1S,2S,6R,7S)-8-oxotricyclo[5.3.0.02,6]decane-1-carboxylate (PubChem CID 11127492) has the molecular formula C12H16O3
and a molecular weight of 208.26 g/mol. Its IUPAC name is methyl (1S,2S,6R,7S)-8-oxotricyclo[5.3.0.02,6]decane-1-carboxylate.
Analyze methyl (1S,2S,6R,7S)-8-oxotricyclo[5.3.0.02,6]decane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (1S,2S,6R,7S)-8-oxotricyclo[5.3.0.02,6]decane-1-carboxylate?
The IUPAC name of methyl (1S,2S,6R,7S)-8-oxotricyclo[5.3.0.02,6]decane-1-carboxylate (CID 11127492) is methyl (1S,2S,6R,7S)-8-oxotricyclo[5.3.0.02,6]decane-1-carboxylate.
What is the SMILES notation for methyl (1S,2S,6R,7S)-8-oxotricyclo[5.3.0.02,6]decane-1-carboxylate?
The canonical SMILES for methyl (1S,2S,6R,7S)-8-oxotricyclo[5.3.0.02,6]decane-1-carboxylate is COC(=O)[C@]12CCC(=O)[C@H]1[C@@H]1CCC[C@@H]12.
What is the InChIKey of methyl (1S,2S,6R,7S)-8-oxotricyclo[5.3.0.02,6]decane-1-carboxylate?
The InChIKey is WDIYAEGOKKQQHP-CCCLYZFWSA-N. The full InChI is InChI=1S/C12H16O3/c1-15-11(14)12-6-5-9(13)10(12)7-3-2-4-8(7)12/h7-8,10H,2-6H2,1H3/t7-,8+,10-,12+/m1/s1.
What are the key properties of methyl (1S,2S,6R,7S)-8-oxotricyclo[5.3.0.02,6]decane-1-carboxylate?
methyl (1S,2S,6R,7S)-8-oxotricyclo[5.3.0.02,6]decane-1-carboxylate has a molecular weight of 208.26 g/mol, XLogP of 1.55, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (1S,2S,6R,7S)-8-oxotricyclo[5.3.0.02,6]decane-1-carboxylate is sourced from PubChem (CID 11127492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).