C22H30O4 — CID 100960278
dimethyl pentacyclo[6.5.5.02,7.09,13.014,18]octadec-2(7)-ene-4,4-dicarboxylate (PubChem CID 100960278) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is dimethyl pentacyclo[6.5.5.02,7.09,13.014,18]octadec-2(7)-ene-4,4-dicarboxylate.
| Compound Name | dimethyl pentacyclo[6.5.5.02,7.09,13.014,18]octadec-2(7)-ene-4,4-dicarboxylate |
|---|---|
| PubChem CID | 100960278 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | dimethyl pentacyclo[6.5.5.02,7.09,13.014,18]octadec-2(7)-ene-4,4-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CCC2=C(C1)C1C3CCCC3C2C2CCCC21 |
| InChI | InChI=1S/C22H30O4/c1-25-20(23)22(21(24)26-2)10-9-16-17(11-22)19-14-7-3-5-12(14)18(16)13-6-4-8-15(13)19/h12-15,18-19H,3-11H2,1-2H3 |
| InChIKey | XINBYRSKRFJGHW-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|