About cis-methyl (1S,2S)-1,2-dimethoxycyclopentane-1-carboxylate
cis-methyl (1S,2S)-1,2-dimethoxycyclopentane-1-carboxylate (PubChem CID 68728052) has the molecular formula C9H16O4
and a molecular weight of 188.22 g/mol. Its IUPAC name is cis-methyl (1S,2S)-1,2-dimethoxycyclopentane-1-carboxylate.
Analyze cis-methyl (1S,2S)-1,2-dimethoxycyclopentane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-methyl (1S,2S)-1,2-dimethoxycyclopentane-1-carboxylate?
The IUPAC name of cis-methyl (1S,2S)-1,2-dimethoxycyclopentane-1-carboxylate (CID 68728052) is cis-methyl (1S,2S)-1,2-dimethoxycyclopentane-1-carboxylate.
What is the SMILES notation for cis-methyl (1S,2S)-1,2-dimethoxycyclopentane-1-carboxylate?
The canonical SMILES for cis-methyl (1S,2S)-1,2-dimethoxycyclopentane-1-carboxylate is COC(=O)[C@]1(OC)CCC[C@@H]1OC.
What is the InChIKey of cis-methyl (1S,2S)-1,2-dimethoxycyclopentane-1-carboxylate?
The InChIKey is ZZRPMJVCTBNALC-CBAPKCEASA-N. The full InChI is InChI=1S/C9H16O4/c1-11-7-5-4-6-9(7,13-3)8(10)12-2/h7H,4-6H2,1-3H3/t7-,9-/m0/s1.
What are the key properties of cis-methyl (1S,2S)-1,2-dimethoxycyclopentane-1-carboxylate?
cis-methyl (1S,2S)-1,2-dimethoxycyclopentane-1-carboxylate has a molecular weight of 188.22 g/mol, XLogP of 0.74, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cis-methyl (1S,2S)-1,2-dimethoxycyclopentane-1-carboxylate is sourced from PubChem (CID 68728052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).