About methyl (3R,4S)-3,4-dimethoxypiperidine-4-carboxylate;hydrochloride
methyl (3R,4S)-3,4-dimethoxypiperidine-4-carboxylate;hydrochloride (PubChem CID 154577268) has the molecular formula C9H18ClNO4
and a molecular weight of 239.70 g/mol. Its IUPAC name is methyl (3R,4S)-3,4-dimethoxypiperidine-4-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | methyl (3R,4S)-3,4-dimethoxypiperidine-4-carboxylate;hydrochloride |
| PubChem CID | 154577268 |
| Molecular Formula | C9H18ClNO4 |
| Molecular Weight | 239.70 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | methyl (3R,4S)-3,4-dimethoxypiperidine-4-carboxylate;hydrochloride |
| SMILES | COC(=O)[C@]1(OC)CCNC[C@H]1OC.Cl |
| InChI | InChI=1S/C9H17NO4.ClH/c1-12-7-6-10-5-4-9(7,14-3)8(11)13-2;/h7,10H,4-6H2,1-3H3;1H/t7-,9+;/m1./s1 |
| InChIKey | RJNLUGFCEJBZBJ-JXLXBRSFSA-N |
| XLogP | -0.03 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.70 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl (3R,4S)-3,4-dimethoxypiperidine-4-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3R,4S)-3,4-dimethoxypiperidine-4-carboxylate;hydrochloride?
The IUPAC name of methyl (3R,4S)-3,4-dimethoxypiperidine-4-carboxylate;hydrochloride (CID 154577268) is methyl (3R,4S)-3,4-dimethoxypiperidine-4-carboxylate;hydrochloride.
What is the SMILES notation for methyl (3R,4S)-3,4-dimethoxypiperidine-4-carboxylate;hydrochloride?
The canonical SMILES for methyl (3R,4S)-3,4-dimethoxypiperidine-4-carboxylate;hydrochloride is COC(=O)[C@]1(OC)CCNC[C@H]1OC.Cl.
What is the InChIKey of methyl (3R,4S)-3,4-dimethoxypiperidine-4-carboxylate;hydrochloride?
The InChIKey is RJNLUGFCEJBZBJ-JXLXBRSFSA-N. The full InChI is InChI=1S/C9H17NO4.ClH/c1-12-7-6-10-5-4-9(7,14-3)8(11)13-2;/h7,10H,4-6H2,1-3H3;1H/t7-,9+;/m1./s1.
What are the key properties of methyl (3R,4S)-3,4-dimethoxypiperidine-4-carboxylate;hydrochloride?
methyl (3R,4S)-3,4-dimethoxypiperidine-4-carboxylate;hydrochloride has a molecular weight of 239.70 g/mol, XLogP of -0.03, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3R,4S)-3,4-dimethoxypiperidine-4-carboxylate;hydrochloride is sourced from PubChem (CID 154577268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).