cis-(1R,2R)-1-amino-2-methoxycyclopentane-1-carboxylic acid

C7H13NO3 — CID 102073305

IUPACcis-(1R,2R)-1-amino-2-methoxycyclopentane-1-carboxylic acid
SMILESCO[C@@H]1CCC[C@]1(N)C(=O)O
InChIInChI=1S/C7H13NO3/c1-11-5-3-2-4-7(5,8)6(9)10/h5H,2-4,8H2,1H3,(H,9,10)/t5-,7-/m1/s1
InChIKeyFXSQNRFUTDODIM-IYSWYEEDSA-N
MW159.18 g/mol
LogP-0.03
Rot. Bonds2

About cis-(1R,2R)-1-amino-2-methoxycyclopentane-1-carboxylic acid

cis-(1R,2R)-1-amino-2-methoxycyclopentane-1-carboxylic acid (PubChem CID 102073305) has the molecular formula C7H13NO3 and a molecular weight of 159.18 g/mol. Its IUPAC name is cis-(1R,2R)-1-amino-2-methoxycyclopentane-1-carboxylic acid.

Molecular Properties

Compound Namecis-(1R,2R)-1-amino-2-methoxycyclopentane-1-carboxylic acid
PubChem CID102073305
Molecular FormulaC7H13NO3
Molecular Weight159.18 g/mol
Exact Mass159.09
IUPAC Namecis-(1R,2R)-1-amino-2-methoxycyclopentane-1-carboxylic acid
SMILESCO[C@@H]1CCC[C@]1(N)C(=O)O
InChIInChI=1S/C7H13NO3/c1-11-5-3-2-4-7(5,8)6(9)10/h5H,2-4,8H2,1H3,(H,9,10)/t5-,7-/m1/s1
InChIKeyFXSQNRFUTDODIM-IYSWYEEDSA-N
XLogP-0.03
TPSA72.55 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500159.18
LogP ≤ 5-0.03
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze cis-(1R,2R)-1-amino-2-methoxycyclopentane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cis-(1R,2R)-1-amino-2-methoxycyclopentane-1-carboxylic acid?
The IUPAC name of cis-(1R,2R)-1-amino-2-methoxycyclopentane-1-carboxylic acid (CID 102073305) is cis-(1R,2R)-1-amino-2-methoxycyclopentane-1-carboxylic acid.
What is the SMILES notation for cis-(1R,2R)-1-amino-2-methoxycyclopentane-1-carboxylic acid?
The canonical SMILES for cis-(1R,2R)-1-amino-2-methoxycyclopentane-1-carboxylic acid is CO[C@@H]1CCC[C@]1(N)C(=O)O.
What is the InChIKey of cis-(1R,2R)-1-amino-2-methoxycyclopentane-1-carboxylic acid?
The InChIKey is FXSQNRFUTDODIM-IYSWYEEDSA-N. The full InChI is InChI=1S/C7H13NO3/c1-11-5-3-2-4-7(5,8)6(9)10/h5H,2-4,8H2,1H3,(H,9,10)/t5-,7-/m1/s1.
What are the key properties of cis-(1R,2R)-1-amino-2-methoxycyclopentane-1-carboxylic acid?
cis-(1R,2R)-1-amino-2-methoxycyclopentane-1-carboxylic acid has a molecular weight of 159.18 g/mol, XLogP of -0.03, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2R)-1-amino-2-methoxycyclopentane-1-carboxylic acid is sourced from PubChem (CID 102073305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).