C7H13BrO — CID 101131574
cis-(1S,2S)-1-bromo-2-methoxy-1-methylcyclopentane (PubChem CID 101131574) has the molecular formula C7H13BrO and a molecular weight of 193.08 g/mol. Its IUPAC name is cis-(1S,2S)-1-bromo-2-methoxy-1-methylcyclopentane.
| Compound Name | cis-(1S,2S)-1-bromo-2-methoxy-1-methylcyclopentane |
|---|---|
| PubChem CID | 101131574 |
| Molecular Formula | C7H13BrO |
| Molecular Weight | 193.08 g/mol |
| Exact Mass | 192.01 |
| IUPAC Name | cis-(1S,2S)-1-bromo-2-methoxy-1-methylcyclopentane |
| SMILES | CO[C@H]1CCC[C@]1(C)Br |
| InChI | InChI=1S/C7H13BrO/c1-7(8)5-3-4-6(7)9-2/h6H,3-5H2,1-2H3/t6-,7-/m0/s1 |
| InChIKey | DTAPMLOXBMTACP-BQBZGAKWSA-N |
| XLogP | 2.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.08 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|