C7H15NO — CID 134461994
O-(2,2-dimethylcyclopentyl)hydroxylamine (PubChem CID 134461994) has the molecular formula C7H15NO and a molecular weight of 129.20 g/mol. Its IUPAC name is O-(2,2-dimethylcyclopentyl)hydroxylamine.
| Compound Name | O-(2,2-dimethylcyclopentyl)hydroxylamine |
|---|---|
| PubChem CID | 134461994 |
| Molecular Formula | C7H15NO |
| Molecular Weight | 129.20 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | O-(2,2-dimethylcyclopentyl)hydroxylamine |
| SMILES | CC1(C)CCCC1ON |
| InChI | InChI=1S/C7H15NO/c1-7(2)5-3-4-6(7)9-8/h6H,3-5,8H2,1-2H3 |
| InChIKey | VDTVKNMJMXOZEQ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.20 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|