C9H17NO — CID 90019535
(1S)-2,2-dimethylcyclohexane-1-carboxamide (PubChem CID 90019535) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is (1S)-2,2-dimethylcyclohexane-1-carboxamide.
| Compound Name | (1S)-2,2-dimethylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 90019535 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | (1S)-2,2-dimethylcyclohexane-1-carboxamide |
| SMILES | CC1(C)CCCC[C@@H]1C(N)=O |
| InChI | InChI=1S/C9H17NO/c1-9(2)6-4-3-5-7(9)8(10)11/h7H,3-6H2,1-2H3,(H2,10,11)/t7-/m1/s1 |
| InChIKey | PELGOGLGESFOKA-SSDOTTSWSA-N |
| XLogP | 1.69 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |