C11H20N2O3 — CID 107180286
N-(2-amino-2-oxoethoxy)-2,2-dimethylcyclohexane-1-carboxamide (PubChem CID 107180286) has the molecular formula C11H20N2O3 and a molecular weight of 228.29 g/mol. Its IUPAC name is N-(2-amino-2-oxoethoxy)-2,2-dimethylcyclohexane-1-carboxamide.
| Compound Name | N-(2-amino-2-oxoethoxy)-2,2-dimethylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 107180286 |
| Molecular Formula | C11H20N2O3 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | N-(2-amino-2-oxoethoxy)-2,2-dimethylcyclohexane-1-carboxamide |
| SMILES | CC1(C)CCCCC1C(=O)NOCC(N)=O |
| InChI | InChI=1S/C11H20N2O3/c1-11(2)6-4-3-5-8(11)10(15)13-16-7-9(12)14/h8H,3-7H2,1-2H3,(H2,12,14)(H,13,15) |
| InChIKey | IAUQXXVCQWYEGY-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|