C9H17NO2 — CID 87324456
N-hydroxy-2,2-dimethylcyclohexane-1-carboxamide (PubChem CID 87324456) has the molecular formula C9H17NO2 and a molecular weight of 171.24 g/mol. Its IUPAC name is N-hydroxy-2,2-dimethylcyclohexane-1-carboxamide.
| Compound Name | N-hydroxy-2,2-dimethylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 87324456 |
| Molecular Formula | C9H17NO2 |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.13 |
| IUPAC Name | N-hydroxy-2,2-dimethylcyclohexane-1-carboxamide |
| SMILES | CC1(C)CCCCC1C(=O)NO |
| InChI | InChI=1S/C9H17NO2/c1-9(2)6-4-3-5-7(9)8(11)10-12/h7,12H,3-6H2,1-2H3,(H,10,11) |
| InChIKey | YKXGANOUNBUTOD-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|