C11H22N2O3S — CID 107182865
2,2-dimethyl-N-(2-sulfamoylethyl)cyclohexane-1-carboxamide (PubChem CID 107182865) has the molecular formula C11H22N2O3S and a molecular weight of 262.37 g/mol. Its IUPAC name is 2,2-dimethyl-N-(2-sulfamoylethyl)cyclohexane-1-carboxamide.
| Compound Name | 2,2-dimethyl-N-(2-sulfamoylethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 107182865 |
| Molecular Formula | C11H22N2O3S |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 2,2-dimethyl-N-(2-sulfamoylethyl)cyclohexane-1-carboxamide |
| SMILES | CC1(C)CCCCC1C(=O)NCCS(N)(=O)=O |
| InChI | InChI=1S/C11H22N2O3S/c1-11(2)6-4-3-5-9(11)10(14)13-7-8-17(12,15)16/h9H,3-8H2,1-2H3,(H,13,14)(H2,12,15,16) |
| InChIKey | ITDLWGKJZRWAJF-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |